nikim6990 nikim6990

15-12-2022
Mathematics

contestada

A(-2,3), B(2,4), C(5,5), D(8,6)
Find the coordinates of the point of the intersection P of the line AB

Respuesta :

Otras preguntas

Gwent pour 256 milliliters of water in to Ravi Henry pours 189 milliters of water in to Ravis .Ravis now contains 800 Milliters of water hiw nuch water was in R

A diatomic molecule shares three pairs of electrons. What type of bond is present in the molecule? A single covalent bond because each atom requires one more

Which of the statements below is false? Question 19 options: a) You can install a 64-bit operating system on a 64-bit machine. b) You can install a 64-bit

why should corporal punishment not be brought back into schools ?

1. How did pan bands come into existence? 2. What is the term for a musician who plays the bongos? 3. In what three ways can the shekere be played?

This landform is the result of water and wind erosion What do we call this landform? A) a delta B) a valley C) a canyon D) a mountain

Using the addition or subtraction formulas for sine or cosine... sin(a)sin(b)=(sin(a+b)+sin(a-b))/2

What do you regard as the most important rights and liberties that we possess as americans

An advantage of reproduction is that a genetic disorder in a parent might not affect the offspring.

For a client with difficulty swallowing, the nurse should crush which medication?