11-02-2019
History

contestada

How was war different in world war 1 why did world war two result in so many casualties

Respuesta :

11-02-2019

WWII devastated Europe. WWI was different because people were trying new things, like weapons and a lot of new and stunning technology.

Answer Link

joey8292004 joey8292004

08-11-2019

Answer: New Types of War and Weapons

Explanation:

Answer Link

Otras preguntas

According to Hitler, the most important facet of the German economy was __________.

why are the products in the philippines written in english even though tagalog is their original language and other countries are the product is only their own

write the two next term:1;3;6;10

explicacion de elevando al cubo a+b

Find the area of a circle with radius, r = 79cm. Give your answer rounded to 3 SF.

Which statement is FALSE regarding Japanese stylistic influences on this specific Van Gogh painting?

(x+5)²=9 Difference of 2 squares quadratic equation solve (please show full working)

the diagram shows graphs of y=1/2x+2 and 2y+2x=12. Use the diagram to solve the simultaneous equations

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

Is. (e) (i) You mustn't... (ii) Drink.. when..