sic16 sic16
  • 13-06-2016
  • Mathematics
contestada

Find the exact values of cos 0 and sin 0 for -120

Respuesta :

nobillionaireNobley
nobillionaireNobley nobillionaireNobley
  • 15-06-2016
[tex]sin (-120) = sin(180-60)=sin60= \frac{ \sqrt{3} }{2} \\ cos(-120)=-cos(180-60)=-cos60=- \frac{1}{2} [/tex]
Answer Link

Otras preguntas

What are the physical states in which water can exist in the atmosphere? Give an example of how we can sense each state.
What type of reaction is 2Mg + 2HCL ­­­­­> 2MgCl + H2 + heat?
who were Anddrew Jackson
if a factory can produce 211 bicycles in 1 month how many can they produce in 1 year
What is the name of the offensive that even though it was an american victory changed public opinion on the war in vietnam? Tet Offensive Linebacker 1 Lineback
who began Quebec, the first permanent French colony.
What was one outcome of price supports for farmers
If a red cow (homozygous dominant) is crossed with a white cow (homozygous dominant), what alleles will the offspring have? A.Rw B.RW C.rW D.rw
the height of a triangle is 1 cm less than twice the length of the base. let x = the length of the base
Which expression is equivalent to 1/3 b + 2/3 b − 5/6 (b+1) ? 11/6 b − 5/6 1/6 b + 1 1/6 b + 5/6 1/6 b − 5/6 PLZ help!