pickleglocck pickleglocck

11-06-2020
Mathematics

contestada

find an angle x where sin x = cos x (I know this has been answered but I rlly don't get it..)

Respuesta :

yeetosaurus69 yeetosaurus69

11-06-2020

Answer:

45 degrees

Step-by-step explanation:

sin x=cos(90-x)

sin(45)=cos(90-45)=cos(45)

Answer Link

udhayabrol udhayabrol

26-07-2020

Answer:

The answer is 45.

sin45=cos45= 1/√2.

hope it helps u ...

Answer Link

Otras preguntas

Please help me if you can. Questions: 1. How does consumer behaviour affect the quality of life for individuals and groups in Canada and the U.S.? 2. What affe

The question is Solve for x

what is solution to 12²-5²

The rectangular top of Kathleen's desk has a length of 24 inches and a width of 17 inches. What is the area of the top of Kathleen's desk in square inches?

Which sentence revise the best enemas of the story setting

Complementary, Supplementary or neither?

Which physical feature has often served as a barrier for trade and travel in South Asia?

what is rand between in excel

Describe the message each artist wanted to convey to the observer

10 points!! Describe the reaction of the Three Musketeers when Madame Bonacieux dies. Do they dismiss D'Artagnan's sorrow or respect it? Does their reaction see