joanonso123 joanonso123

12-03-2021
Chemistry

contestada

How would someone describe a passing grade

Respuesta :

zamyaoutlar1025 zamyaoutlar1025

12-03-2021

A passing grade is a grade that makes a person eligible to go to the next grade.

Answer Link

Otras preguntas

According to esherick, why did the boxer rebellion become such a famous historical event?

What was the 18th Amendment? What was its purpose? What were some things that happened as a result?

1.this substance is a natural non-living material with a uniform structure throughout A) Mineral B) Rock 2. Any rock can become a/an (igneous, metamorphic, or s

I have no idea please walk me though it in the comments and then answer

PLEASE HELP!!!! 20POINTSSSSS Explain the difference between human geography and culture

Up most of the side canyons, before dam nation, there were springs, sometimes flowing streams, waterfalls and plunge pools the kind of marvels you can now find

Conplete the square to solve the quadratic equation. x[tex]1 {x}^{2} - 6x + 12 = 2x + 20[/tex]

How does the author's use of the closet in paragraph 44 contribute to the meaning of the story? use evidence from the text to support your answer?

sin(76)cos(31)-cos(76)sin(31)

....................