jacob4ever jacob4ever

16-01-2017
Mathematics

contestada

How can I tell if a set of bivariate data shows a linear relationship?

Respuesta :

17-01-2017

make a scatterplot of the data. then look at the scatterplot to see if the data taken holistically appears to be close to the shape of the line

Answer Link

Otras preguntas

If you wanted to design a poster for a concert, which would be highly eye-catching?

In a graph, x represents the number of months since a business opened, and y represents the total amount of money the business has earned. The following three p

the diagram below shows several of the processes involved in the carbon cycle, but they are not labeled. use the labels to correctly identify each process

Which one is the right answer

Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please

which part of the cell membrane does not mix with water

What is the volume, in cubic meters, if the prism below?

What impact does your family have on air pollution? Find out how much carbon dioxide your family’s car releases. a. First find out how many gallons of gasoline

It is easier to determine the electron configurations for the p-block elements in periods 1, 2, and 3 than to determine the electron configurations for the rest

the combustion of 17.41 grams of a compound known to only contain carbon, hydrogen, and oxygen produced 25.61 grams of carbon dioxide and 10.48 grams of water.